Products 335595-58-9
CAS 335595-58-9 is the registry number for 1-O-Acetyl 2,3,5-tri-O-benzoyl-beta-D-ribofuranoside-13C. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
[(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxy(513C)oxolan-2-yl]methyl benzoate (CAS 335595-58-9) is a chemical compound with the molecular formula C28H24O9 and a molecular weight of 505.5 g/mol. IUPAC name: [(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxy(513C)oxolan-2-yl]methyl benzoate. InChIKey: GCZABPLTDYVJMP-IUEDBPNLSA-N.
| Molecular formula | C28H24O9 |
|---|---|
| Molecular weight | 505.5 g/mol |
| IUPAC name | [(2R,3R,4R,5S)-5-acetyloxy-3,4-dibenzoyloxy(513C)oxolan-2-yl]methyl benzoate |
| InChIKey | GCZABPLTDYVJMP-IUEDBPNLSA-N |
| SMILES | CC(=O)O[13C@H]1[C@@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)