CAS 70832-64-3 appears in our catalog under these names: (2R,3R,4R,5R)-2-Acetoxy-5-((benzoyloxy)methyl)tetrahydrofuran-3,4-diyl dibenzoate, 97%, Clofarabine Impurity 4, alpha-D-Ribofuranose 1-acetate2,3,5-tribenzoate, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g, 10g.
[(2R,3R,4R,5R)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (CAS 70832-64-3) is a chemical compound with the molecular formula C28H24O9 and a molecular weight of 504.5 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate. InChIKey: GCZABPLTDYVJMP-MUCKBHKGSA-N.
| Molecular formula | C28H24O9 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-acetyloxy-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | GCZABPLTDYVJMP-MUCKBHKGSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)