cas: 4973-29-9 — see every product listed under this CAS number, including other names
1-Phenoxy-4-vinylbenzene (CAS 4973-29-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243225-1G |
| cas | 4973-29-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 1263.11 Pln | |
| Fluorochem | 100g | 4902.46 Pln |
| delivery time | 1-2 weeks |
|---|
1-ethenyl-4-phenoxybenzene (CAS 4973-29-9) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1-ethenyl-4-phenoxybenzene. InChIKey: UULPGUKSBAXNJN-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1-ethenyl-4-phenoxybenzene |
| InChIKey | UULPGUKSBAXNJN-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)