cas: 4973-29-9 — see every product listed under this CAS number, including other names
4-Phenoxystyrene 95% (CAS 4973-29-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A544249-250mg |
| cas | 4973-29-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 314.75 Pln | |
| Ambeed | 25g | 1277.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A544249 |
1-ethenyl-4-phenoxybenzene (CAS 4973-29-9) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1-ethenyl-4-phenoxybenzene. InChIKey: UULPGUKSBAXNJN-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1-ethenyl-4-phenoxybenzene |
| InChIKey | UULPGUKSBAXNJN-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)