cas: 14172-55-5 — see every product listed under this CAS number, including other names
1-Phenyl sulfonyl piperazine, 98% (CAS 14172-55-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022076-250MG |
| cas | 14172-55-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 758.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-(benzenesulfonyl)piperazine (CAS 14172-55-5) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 1-(benzenesulfonyl)piperazine. InChIKey: NANQJUFFKXWVJR-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 1-(benzenesulfonyl)piperazine |
| InChIKey | NANQJUFFKXWVJR-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)