Products 927983-10-6

CAS 927983-10-6 is the registry number for 2-(Cyclopentylamino)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(cyclopentylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 927983-10-6) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 2-(cyclopentylamino)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: CXFBKDIZGGDBRD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O2S
Molecular weight226.30 g/mol
IUPAC name2-(cyclopentylamino)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyCXFBKDIZGGDBRD-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)NC2CCCC2)C(=O)O

Computed by PubChem (NCBI)