CAS 3900-79-6 appears in our catalog under these names: 4-Methyl-n'-(propan-2-ylidene)benzene-1-sulfonohydrazide, 95%, p-Toluenesulfonyl acetone hydrazone, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 10g, 100g, 5g, 1g, 250mg.
4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide (CAS 3900-79-6) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide. InChIKey: XJXJLURHJAVZJI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 4-methyl-N-(propan-2-ylideneamino)benzenesulfonamide |
| InChIKey | XJXJLURHJAVZJI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NN=C(C)C |
Computed by PubChem (NCBI)