CAS 105297-10-7 appears in our catalog under these names: 4-(4-aminophenyl)thiomorpholine-1,1-dione, 95%, 4–(4–Aminophenyl)thiomorpholine 1,1–Dioxide, 4-(4-Aminophenyl)thiomorpholine 1,1-Dioxide, 4-(4-Aminophenyl)thiomorpholine 1,1-Dioxide, >98.0%(GC)(T), 4-(1,1-Dioxidothiomorpholin-4-yl)aniline 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 100mg.
4-(1,1-dioxo-1,4-thiazinan-4-yl)aniline (CAS 105297-10-7) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 4-(1,1-dioxo-1,4-thiazinan-4-yl)aniline. InChIKey: PLQZCPNIYKUNPR-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)aniline |
| InChIKey | PLQZCPNIYKUNPR-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)