CAS 927996-82-5 is the registry number for 1-(Ethanesulfonyl)-2,3-dihydro-1h-indol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-ethylsulfonyl-2,3-dihydroindol-5-amine (CAS 927996-82-5) is a chemical compound with the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. IUPAC name: 1-ethylsulfonyl-2,3-dihydroindol-5-amine. InChIKey: VSBZVFRUSHGUEP-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2S |
|---|---|
| Molecular weight | 226.30 g/mol |
| IUPAC name | 1-ethylsulfonyl-2,3-dihydroindol-5-amine |
| InChIKey | VSBZVFRUSHGUEP-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)