cas: 59575-91-6 — see every product listed under this CAS number, including other names
1-Phenyl-1-pyridin-2-ylmethanamine DiHCl, 95%, 95% (CAS 59575-91-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAGD-100mg |
| cas | 59575-91-6 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 500mg | 1182.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Phenyl(pyridin-2-yl)methanamine;hydrochloride (CAS 59575-91-6) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: phenyl(pyridin-2-yl)methanamine;hydrochloride. InChIKey: GVGSFONXPJCBIS-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | phenyl(pyridin-2-yl)methanamine;hydrochloride |
| InChIKey | GVGSFONXPJCBIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=N2)N.Cl |
Computed by PubChem (NCBI)