CAS 6590-45-0 appears in our catalog under these names: N1-Phenylbenzene-1,3-diamine hydrochloride, 95%, N1-Phenylbenzene-1,3-diamine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-N-phenylbenzene-1,3-diamine;hydrochloride (CAS 6590-45-0) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 3-N-phenylbenzene-1,3-diamine;hydrochloride. InChIKey: ZVAATBITZAHAKA-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 3-N-phenylbenzene-1,3-diamine;hydrochloride |
| InChIKey | ZVAATBITZAHAKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)