CAS 7711-25-3 appears in our catalog under these names: 1-N-Phenylbenzene-1,2-diamine hydrochloride, 95%, N1-Phenylbenzene-1,2-diamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2-N-phenylbenzene-1,2-diamine;hydrochloride (CAS 7711-25-3) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 2-N-phenylbenzene-1,2-diamine;hydrochloride. InChIKey: QDAKPTLLVBBHMP-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 2-N-phenylbenzene-1,2-diamine;hydrochloride |
| InChIKey | QDAKPTLLVBBHMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2N.Cl |
Computed by PubChem (NCBI)