CAS 59575-91-6 appears in our catalog under these names: Phenyl(pyridin-2-yl)methanamine hydrochloride, 98%, 1-Phenyl-1-pyridin-2-ylmethanamine dihydrochloride, 97%, 1-Phenyl-1-pyridin-2-ylmethanamine dihydrochloride, 95% , 1-Phenyl-1-pyridin-2-ylmethanamine DiHCl, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific, Chemat. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 500mg.
Phenyl(pyridin-2-yl)methanamine;hydrochloride (CAS 59575-91-6) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: phenyl(pyridin-2-yl)methanamine;hydrochloride. InChIKey: GVGSFONXPJCBIS-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | phenyl(pyridin-2-yl)methanamine;hydrochloride |
| InChIKey | GVGSFONXPJCBIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=N2)N.Cl |
Computed by PubChem (NCBI)