cas: 59575-91-6 — see every product listed under this CAS number, including other names
1-Phenyl-1-pyridin-2-ylmethanamine dihydrochloride, 95% (CAS 59575-91-6) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | BTB10358CB |
| cas | 59575-91-6 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 428.65 Pln | |
| Thermo Scientific | 1g | 1140.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
Phenyl(pyridin-2-yl)methanamine;hydrochloride (CAS 59575-91-6) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: phenyl(pyridin-2-yl)methanamine;hydrochloride. InChIKey: GVGSFONXPJCBIS-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | phenyl(pyridin-2-yl)methanamine;hydrochloride |
| InChIKey | GVGSFONXPJCBIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=N2)N.Cl |
Computed by PubChem (NCBI)