Products 362640-59-3
CAS 362640-59-3 appears in our catalog under these names: 1-Phenyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid, 97%, 97%, 1-Phenyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 362640-59-3) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: IDYISPLRQSPMME-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 1-phenyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| InChIKey | IDYISPLRQSPMME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)