Products 93618-30-5
CAS 93618-30-5 appears in our catalog under these names: 5-[3-(Trifluoromethyl)phenyl]-1h-pyrazole-3-carboxylic acid, 95%, 5–(3–(Trifluoromethyl)phenyl)–1H–pyrazole–3–carboxylic acid, 3-(3-(Trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylic acid 95%, 3-(3-(Trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylic acid, 95%, 95%, 3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid (CAS 93618-30-5) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid. InChIKey: BHWWKCLKEDCOEF-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid |
| InChIKey | BHWWKCLKEDCOEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)