Products 1260740-53-1
CAS 1260740-53-1 appears in our catalog under these names: 1-[4-(Trifluoromethyl)phenyl]pyrazole-4-carboxylic acid, 95%, 1-(4-(Trifluoromethyl)phenyl)pyrazole-4-carboxylic acid, 1-[4-(Trifluoromethyl)phenyl]pyrazole-4-carboxylic Acid 98%, 1-[4-(Trifluoromethyl)phenyl]pyrazole-4-carboxylic Acid, 98%, 98%, 1-(4-(Trifluoromethyl)phenyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 100mg.
1-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid (CAS 1260740-53-1) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid. InChIKey: LVXUGHWZJOBYDX-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
| InChIKey | LVXUGHWZJOBYDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)