Products 142818-01-7
CAS 142818-01-7 appears in our catalog under these names: 3-(Trifluoromethyl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 97%, 1-Phenyl-3-trifluoromethyl-1H-pyrazole-4-carboxylic acid, 97%, 1–Phenyl–3–trifluoromethyl–1H–pyrazole–4–carboxylic acid, 1-Phenyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97%, 97%, 1-Phenyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 142818-01-7) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: AUYRCXFCCKSUKX-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | AUYRCXFCCKSUKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)