CAS 1038770-76-1 appears in our catalog under these names: 5-(2-(Trifluoromethyl)phenyl)-1h-pyrazole-3-carboxylic acid, 95%, 3-(2-(Trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylic acid, 95%, 3-(2-(Trifluoromethyl)phenyl)-1H-pyrazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
3-[2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid (CAS 1038770-76-1) is a chemical compound with the molecular formula C11H7F3N2O2 and a molecular weight of 256.18 g/mol. IUPAC name: 3-[2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid. InChIKey: BBFVYPZHDREFSP-UHFFFAOYSA-N.
| Molecular formula | C11H7F3N2O2 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 3-[2-(trifluoromethyl)phenyl]-1H-pyrazole-5-carboxylic acid |
| InChIKey | BBFVYPZHDREFSP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)