cas: 2173052-28-1 — see every product listed under this CAS number, including other names
1-Pyrrolidinecarboxylic acid, 3-(hydroxymethyl)-4-(4-methylphenyl)-, 1,1-dimethylethyl ester, (3s,4r)- (CAS 2173052-28-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WJMO-50mg |
| cas | 2173052-28-1 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 333.20 Pln | |
| Chemat | 250mg | 861.20 Pln | |
| Chemat | 1g | 2502.80 Pln |
| delivery time | 3 weeks |
|---|
Tert-butyl (3R,4S)-3-(hydroxymethyl)-4-(4-methylphenyl)pyrrolidine-1-carboxylate (CAS 2173052-28-1) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl (3R,4S)-3-(hydroxymethyl)-4-(4-methylphenyl)pyrrolidine-1-carboxylate. InChIKey: RPFOVEPSPBKSTC-HUUCEWRRSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-(hydroxymethyl)-4-(4-methylphenyl)pyrrolidine-1-carboxylate |
| InChIKey | RPFOVEPSPBKSTC-HUUCEWRRSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]2CN(C[C@@H]2CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)