CAS 2760368-90-7 is the registry number for rel-tert-Butyl (2R,4S,5R)-4-hydroxy-5-methyl-2-phenylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,4S,5R)-4-hydroxy-5-methyl-2-phenylpiperidine-1-carboxylate (CAS 2760368-90-7) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl (2R,4S,5R)-4-hydroxy-5-methyl-2-phenylpiperidine-1-carboxylate. InChIKey: BFLCNCRMBNJPSV-YUELXQCFSA-N.
| Molecular formula | C17H25NO3 |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | tert-butyl (2R,4S,5R)-4-hydroxy-5-methyl-2-phenylpiperidine-1-carboxylate |
| InChIKey | BFLCNCRMBNJPSV-YUELXQCFSA-N |
| SMILES | C[C@@H]1CN([C@H](C[C@@H]1O)C2=CC=CC=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)