cas: 224168-68-7 — see every product listed under this CAS number, including other names
1-Pyrrolidinecarboxylicacid, 3-(iodomethyl)-, 1,1-dimethylethyl ester, (3S)-, 98%, 98% (CAS 224168-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OL0-100mg |
| cas | 224168-68-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 1019.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 224168-68-7) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-MRVPVSSYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)CI |
Computed by PubChem (NCBI)