cas: 479552-81-3 — see every product listed under this CAS number, including other names
1-Tert-Butyl 6-Methyl 3-Bromo-1H-Indole-1,6-Dicarboxylate, 95%, 95% (CAS 479552-81-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKKW-5g |
| cas | 479552-81-3 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1245.20 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 25g | 5795.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 6-O-methyl 3-bromoindole-1,6-dicarboxylate (CAS 479552-81-3) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 3-bromoindole-1,6-dicarboxylate. InChIKey: QGSWCWANVQUOBH-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 3-bromoindole-1,6-dicarboxylate |
| InChIKey | QGSWCWANVQUOBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)