cas: 4067-01-0 — see every product listed under this CAS number, including other names
1-o-Tolyl-pyrrole-2,5-dione (CAS 4067-01-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F026214-250MG |
| cas | 4067-01-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 706.02 Pln | |
| Fluorochem | 1g | 1637.98 Pln |
| delivery time | 3-4 weeks |
|---|
1-(2-methylphenyl)pyrrole-2,5-dione (CAS 4067-01-0) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-(2-methylphenyl)pyrrole-2,5-dione. InChIKey: QYOJZFBQEAZNEW-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-(2-methylphenyl)pyrrole-2,5-dione |
| InChIKey | QYOJZFBQEAZNEW-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)