cas: 194924-96-4 — see every product listed under this CAS number, including other names
1-tert-Butyl 2-methyl 3-oxopyrrolidine-1,2-dicarboxylate, 98%, 98% (CAS 194924-96-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AN4O-100mg |
| cas | 194924-96-4 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 818.00 Pln | |
| Chemat | 50g | 1302.80 Pln | |
| Chemat | 100g | 2061.20 Pln | |
| Chemat | 250g | 3376.40 Pln | |
| Chemat | 500g | 5659.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl 3-oxopyrrolidine-1,2-dicarboxylate (CAS 194924-96-4) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 3-oxopyrrolidine-1,2-dicarboxylate. InChIKey: SZAMWQSLASHJAF-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 3-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | SZAMWQSLASHJAF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C1C(=O)OC |
Computed by PubChem (NCBI)