cas: 1536392-32-1 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl 4-hydroxypiperidine-1,3-dicarboxylate, 97% (CAS 1536392-32-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F764906-100MG |
| cas | 1536392-32-1 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1434.93 Pln | |
| Fluorochem | 250mg | 2320.03 Pln | |
| Fluorochem | 500mg | 3257.20 Pln | |
| Fluorochem | 1g | 4621.31 Pln | |
| Fluorochem | 5g | 13430.71 Pln | |
| Chemat | 100mg | 798.80 Pln | |
| Chemat | 250mg | 1288.40 Pln | |
| Chemat | 500mg | 1816.40 Pln | |
| Chemat | 1g | 2570.00 Pln | |
| Chemat | 5g | 7581.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-O-tert-butyl 3-O-ethyl 4-hydroxypiperidine-1,3-dicarboxylate (CAS 1536392-32-1) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NBGQOBKPQNOEQD-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | NBGQOBKPQNOEQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CCC1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)