Products 194795-69-2

CAS 194795-69-2 is the registry number for O1-tert-butyl O3-ethyl cis-4-hydroxypiperidine-1,3-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypiperidine-1,3-dicarboxylate (CAS 194795-69-2) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NBGQOBKPQNOEQD-ZJUUUORDSA-N.

Identity
Molecular formulaC13H23NO5
Molecular weight273.33 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl (3R,4S)-4-hydroxypiperidine-1,3-dicarboxylate
InChIKeyNBGQOBKPQNOEQD-ZJUUUORDSA-N
SMILESCCOC(=O)[C@@H]1CN(CC[C@@H]1O)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)