CAS 1536392-32-1 appears in our catalog under these names: 1-(tert-Butyl) 3-ethyl 4-hydroxypiperidine-1,3-dicarboxylate, 98%, 1-tert-butyl 3-ethyl 4-hydroxypiperidine-1,3-dicarboxylate, 97%, 97%, 1-tert-Butyl 3-ethyl 4-hydroxypiperidine-1,3-dicarboxylate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 3-O-ethyl 4-hydroxypiperidine-1,3-dicarboxylate (CAS 1536392-32-1) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NBGQOBKPQNOEQD-UHFFFAOYSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | NBGQOBKPQNOEQD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CCC1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)