Products 807331-64-2
CAS 807331-64-2 appears in our catalog under these names: O1-tert-butyl O3-ethyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate, 95%, O1-tert-butyl O3-ethyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 3-O-ethyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate (CAS 807331-64-2) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate. InChIKey: NBGQOBKPQNOEQD-UWVGGRQHSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4S)-4-hydroxypiperidine-1,3-dicarboxylate |
| InChIKey | NBGQOBKPQNOEQD-UWVGGRQHSA-N |
| SMILES | CCOC(=O)[C@H]1CN(CC[C@@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)