cas: 146256-99-7 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate, 98% (CAS 146256-99-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F761204-250MG |
| cas | 146256-99-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2694.90 Pln | |
| Fluorochem | 10g | 4413.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 3-O-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate (CAS 146256-99-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate. InChIKey: JHBUFXKTKCCCKA-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate |
| InChIKey | JHBUFXKTKCCCKA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CC1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)