cas: 146256-99-7 — see every product listed under this CAS number, including other names
Ethyl 1-Boc-4-hydroxypyrrolidine-3-carboxylate, 97%, 97% (CAS 146256-99-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DTB-100mg |
| cas | 146256-99-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1854.80 Pln | |
| Chemat | 25g | 7072.40 Pln | |
| Chemat | 10g | 3472.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate (CAS 146256-99-7) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate. InChIKey: JHBUFXKTKCCCKA-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-hydroxypyrrolidine-1,3-dicarboxylate |
| InChIKey | JHBUFXKTKCCCKA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CC1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)