cas: 170844-49-2 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl pyrrolidine-1,3-dicarboxylate 97% (CAS 170844-49-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391651-1g |
| cas | 170844-49-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 25g | 971.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A391651 |
1-O-tert-butyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate (CAS 170844-49-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate. InChIKey: PKDQVUYUWUHNMG-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate |
| InChIKey | PKDQVUYUWUHNMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)