cas: 324769-00-8 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-methyl 3-ethyl-4-oxopiperidine-1,3-dicarboxylate (CAS 324769-00-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603336-100MG |
| cas | 324769-00-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1101.71 Pln | |
| Fluorochem | 250mg | 2132.60 Pln | |
| Fluorochem | 1g | 5782.36 Pln |
| delivery time | 3-4 weeks |
|---|
1-O-tert-butyl 3-O-methyl 3-ethyl-4-oxopiperidine-1,3-dicarboxylate (CAS 324769-00-8) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-ethyl-4-oxopiperidine-1,3-dicarboxylate. InChIKey: OEMQALJIGCZHRG-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-ethyl-4-oxopiperidine-1,3-dicarboxylate |
| InChIKey | OEMQALJIGCZHRG-UHFFFAOYSA-N |
| SMILES | CCC1(CN(CCC1=O)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)