cas: 28721-08-6 — see every product listed under this CAS number, including other names
10-Methoxy-5H-dibenzo[b,f]azepine-5-carbonyl chloride 95% (CAS 28721-08-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A417622-10mg |
| cas | 28721-08-6 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 1354.94 Pln | |
| Ambeed | 25mg | 2178.19 Pln | |
| Ambeed | 50mg | 3769.06 Pln | |
| Ambeed | 100mg | 6350.06 Pln | |
| Ambeed | 250mg | 10738.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A417622 |
5-methoxybenzo[b][1]benzazepine-11-carbonyl chloride (CAS 28721-08-6) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: 5-methoxybenzo[b][1]benzazepine-11-carbonyl chloride. InChIKey: ANRYPESGCUZAHS-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 5-methoxybenzo[b][1]benzazepine-11-carbonyl chloride |
| InChIKey | ANRYPESGCUZAHS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC=C2N(C3=CC=CC=C31)C(=O)Cl |
Computed by PubChem (NCBI)