CAS 93548-89-1 appears in our catalog under these names: 1H-Indole-3-carboxylic acid, 1-[(4-chlorophenyl)methyl]-, 95%, 1-((4-Chlorophenyl)methyl)-1H-indole-3-carboxylic acid, 95%, 1-((4-Chlorophenyl)methyl)-1H-indole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 5000mg.
1-[(4-chlorophenyl)methyl]indole-3-carboxylic acid (CAS 93548-89-1) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]indole-3-carboxylic acid. InChIKey: OJWPITWTRRQRFX-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]indole-3-carboxylic acid |
| InChIKey | OJWPITWTRRQRFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)