CAS 37041-30-8 appears in our catalog under these names: Ethyl 4-chlorobenzo[h]quinoline-3-carboxylate, 95%, Benzo(h)quinoline-3-carboxylic acid, 4-chloro-, ethyl ester, 97%, ethyl 4–chlorobenzo(h)quinoline–3–carboxylate, ethyl 4-chlorobenzo[h]quinoline-3-carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 4-chlorobenzo[h]quinoline-3-carboxylate (CAS 37041-30-8) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: ethyl 4-chlorobenzo[h]quinoline-3-carboxylate. InChIKey: OUVDIUPLVZVEEN-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | ethyl 4-chlorobenzo[h]quinoline-3-carboxylate |
| InChIKey | OUVDIUPLVZVEEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C1Cl)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)