Products 943109-68-0

CAS 943109-68-0 is the registry number for 1-(2-Chlorobenzyl)-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(2-chlorophenyl)methyl]indole-2-carboxylic acid (CAS 943109-68-0) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]indole-2-carboxylic acid. InChIKey: KDMMRRCLTYHTRA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12ClNO2
Molecular weight285.72 g/mol
IUPAC name1-[(2-chlorophenyl)methyl]indole-2-carboxylic acid
InChIKeyKDMMRRCLTYHTRA-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(N2CC3=CC=CC=C3Cl)C(=O)O

Computed by PubChem (NCBI)