Products 1355248-20-2
CAS 1355248-20-2 is the registry number for Ethyl 4-(3-chloro-4-cyanophenyl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 4-(3-chloro-4-cyanophenyl)benzoate (CAS 1355248-20-2) is a chemical compound with the molecular formula C16H12ClNO2 and a molecular weight of 285.72 g/mol. IUPAC name: ethyl 4-(3-chloro-4-cyanophenyl)benzoate. InChIKey: KZGJDGVIUOZFLY-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO2 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | ethyl 4-(3-chloro-4-cyanophenyl)benzoate |
| InChIKey | KZGJDGVIUOZFLY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)