CAS 1416711-61-9 appears in our catalog under these names: Sulfachloropyrazine 13C6 (phenyl 13C6), Sulfachloropyrazine 13C6 (phenyl 13C6) 100 µg/mL in Acetonitrile, 13C6-Sulfachloropyrazine, Concentration: 100 µg/ml Solvent: Methanol, 13C6-Sulfachloropyrazine. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1ml, 1x1ml, 1x10mg.
4-amino-N-(6-chloropyrazin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide (CAS 1416711-61-9) is a chemical compound with the molecular formula C10H9ClN4O2S and a molecular weight of 290.68 g/mol. IUPAC name: 4-amino-N-(6-chloropyrazin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide. InChIKey: QKLPUVXBJHRFQZ-UQUYMPKGSA-N.
| Molecular formula | C10H9ClN4O2S |
|---|---|
| Molecular weight | 290.68 g/mol |
| IUPAC name | 4-amino-N-(6-chloropyrazin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| InChIKey | QKLPUVXBJHRFQZ-UQUYMPKGSA-N |
| SMILES | C1=C(N=C(C=N1)Cl)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N |
Computed by PubChem (NCBI)