Products 1420043-61-3
CAS 1420043-61-3 appears in our catalog under these names: Tolfenamic Acid-13C6, Tolfenamic acid-13C6, 99.7%, 13C6-Tolfenamic acid, Concentration: 100 µg/ml Solvent: Acetonitrile, 13C6-Tolfenamic acid. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 5 mg, 1x1ml, 1x10mg.
6-(3-chloro-2-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1420043-61-3) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 267.66 g/mol. IUPAC name: 6-(3-chloro-2-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: YEZNLOUZAIOMLT-CDLMHYHCSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 267.66 g/mol |
| IUPAC name | 6-(3-chloro-2-methylanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | YEZNLOUZAIOMLT-CDLMHYHCSA-N |
| SMILES | CC1=C(C=CC=C1Cl)N[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2C(=O)O |
Computed by PubChem (NCBI)