cas: 355-28-2 — see every product listed under this CAS number, including other names
1H,1H-Perfluoropentan-1-ol (CAS 355-28-2) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007150-200MG |
| cas | 355-28-2 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 195.78 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 25g | 3881.98 Pln |
| delivery time | 3-4 weeks |
|---|
2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol (CAS 355-28-2) is a chemical compound with the molecular formula C5H3F9O and a molecular weight of 250.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol. InChIKey: PJRIQFXPYMVWOU-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol |
| InChIKey | PJRIQFXPYMVWOU-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)