cas: 355-28-2 — see every product listed under this CAS number, including other names
1H,1H-Nonafluoropentan-1-ol 98% (CAS 355-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A422062-1g |
| cas | 355-28-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1560.75 Pln | |
| Ambeed | 25g | 3057.06 Pln | |
| Ambeed | 100g | 9620.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A422062 |
2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol (CAS 355-28-2) is a chemical compound with the molecular formula C5H3F9O and a molecular weight of 250.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol. InChIKey: PJRIQFXPYMVWOU-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O |
|---|---|
| Molecular weight | 250.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol |
| InChIKey | PJRIQFXPYMVWOU-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)