cas: 4886-29-7 — see every product listed under this CAS number, including other names
1H-Benzimidazole, 5-chloro-2-(1-methylethyl)-, 97%, 97% (CAS 4886-29-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBKI-1g |
| cas | 4886-29-7 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 990.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2-propan-2-yl-1H-benzimidazole (CAS 4886-29-7) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 6-chloro-2-propan-2-yl-1H-benzimidazole. InChIKey: GAFJAHXSMPRMJQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-chloro-2-propan-2-yl-1H-benzimidazole |
| InChIKey | GAFJAHXSMPRMJQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)