cas: 4886-29-7 — see every product listed under this CAS number, including other names
6-Chloro-2-isopropyl-1H-benzo[d]imidazole 95% (CAS 4886-29-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110007-5g |
| cas | 4886-29-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 1015.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A110007 |
6-chloro-2-propan-2-yl-1H-benzimidazole (CAS 4886-29-7) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 6-chloro-2-propan-2-yl-1H-benzimidazole. InChIKey: GAFJAHXSMPRMJQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-chloro-2-propan-2-yl-1H-benzimidazole |
| InChIKey | GAFJAHXSMPRMJQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)