cas: 1007206-54-3 — see every product listed under this CAS number, including other names
1H-Benzimidazole-5-boronic acid pinacol ester, 95% (CAS 1007206-54-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092791-250MG |
| cas | 1007206-54-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 596.68 Pln | |
| Fluorochem | 10g | 1132.95 Pln | |
| Fluorochem | 25g | 2226.32 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole (CAS 1007206-54-3) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole. InChIKey: HCWNKNYTHLBIHX-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole |
| InChIKey | HCWNKNYTHLBIHX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CN3 |
Computed by PubChem (NCBI)