CAS 945256-29-1 appears in our catalog under these names: 1H-Pyrrolo[2,3-b]pyridine-3-boronic acid pinacol ester, 98%, 7–Azaindole–3–boronic Acid Pinacol Ester, 1H-Pyrrolo(2,3-b)pyridine-3-boronic acid pinacol ester, 7-Azaindole-3-boronic Acid Pinacol Ester, 97%, 97%, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine (CAS 945256-29-1) is a chemical compound with the molecular formula C13H17BN2O2 and a molecular weight of 244.10 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: UDWFQODVYQOMET-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O2 |
|---|---|
| Molecular weight | 244.10 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | UDWFQODVYQOMET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CNC3=C2C=CC=N3 |
Computed by PubChem (NCBI)