CAS 338454-14-1 appears in our catalog under these names: 1H–Indazole–5–boronic acid, 1H-Indazole-5-boronic acid, 1H-INDAZOLE-5-BORONIC ACID, >=95%, 1H-Indazole-5-boronic acid, 97%, 97%, Indazole-5-boronic acid, 97%. Offered by: GLPBio, Biosynth, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 50g, 100mg, 5g, 10g.
1H-indazol-5-ylboronic acid (CAS 338454-14-1) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-5-ylboronic acid. InChIKey: CLVPGJWAMIADSY-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-5-ylboronic acid |
| InChIKey | CLVPGJWAMIADSY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)NN=C2)(O)O |
Computed by PubChem (NCBI)