CAS 2225180-00-5 appears in our catalog under these names: (6-Cyano-2-methylpyridin-3-yl)boronic acid, 95%, (6–CYANO–2–METHYLPYRIDIN–3–YL)BORONIC ACID. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg, 100mg, 25mg, 5mg.
(6-cyano-2-methyl-3-pyridinyl)boronic acid (CAS 2225180-00-5) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: (6-cyano-2-methyl-3-pyridinyl)boronic acid. InChIKey: LVULONDIXVUBGI-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | (6-cyano-2-methyl-3-pyridinyl)boronic acid |
| InChIKey | LVULONDIXVUBGI-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C#N)C)(O)O |
Computed by PubChem (NCBI)