CAS 885068-10-0 appears in our catalog under these names: Indazole-6-boronic acid, 98%, 1H-Indazol-6-ylboronic acid, 97%, 1H-Indazol-6-yl-6-boronic acid 97%, INDAZOLE-6-BORONIC ACID, 1H-Indazol-6-ylboronic acid, 97%, 97%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250MG.
1H-indazol-6-ylboronic acid (CAS 885068-10-0) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-6-ylboronic acid. InChIKey: ZKNLCHWRWRYPGG-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-6-ylboronic acid |
| InChIKey | ZKNLCHWRWRYPGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NN2)(O)O |
Computed by PubChem (NCBI)