CAS 944059-24-9 appears in our catalog under these names: 1H-Pyrrolo[2,3-b]pyridin-5-ylboronic acid, 97%, (1H-Pyrrolo[2,3-b]pyridin-5-yl)boronic acid 97%, (1H-Pyrrolo[2,3-b]pyridin-5-yl)boronic acid, 97%, 97%, (1H-Pyrrolo[2,3-b]pyridin-5-yl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg, 500mg.
1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid (CAS 944059-24-9) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid. InChIKey: KCHKRCSVKZQYCA-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid |
| InChIKey | KCHKRCSVKZQYCA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(NC=C2)N=C1)(O)O |
Computed by PubChem (NCBI)